Products 495-75-0
CAS 495-75-0 appears in our catalog under these names: 2,5-Anhydro-d-mannose, 97%, Mannose Impurity 8, 2,5-Anhydro-D-mannose, >95% (HPLC), 2,5-Anhydro-D-mannofuranose, 2,5-Anhydro-D-mannose. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 100 mg.
(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbaldehyde (CAS 495-75-0) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. IUPAC name: (2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbaldehyde. InChIKey: LKAPTZKZHMOIRE-KVTDHHQDSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolane-2-carbaldehyde |
| InChIKey | LKAPTZKZHMOIRE-KVTDHHQDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](O1)C=O)O)O)O |
Computed by PubChem (NCBI)