CAS 495414-28-3 is the registry number for 1',3'-Dihydrospiro(cyclobutane-1,2'-inden)-3'-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Spiro[3H-indene-2,1'-cyclobutane]-1-one (CAS 495414-28-3) is a chemical compound with the molecular formula C12H12O and a molecular weight of 172.22 g/mol. IUPAC name: spiro[3H-indene-2,1'-cyclobutane]-1-one. InChIKey: JALMCDIFOWIFCH-UHFFFAOYSA-N.
| Molecular formula | C12H12O |
|---|---|
| Molecular weight | 172.22 g/mol |
| IUPAC name | spiro[3H-indene-2,1'-cyclobutane]-1-one |
| InChIKey | JALMCDIFOWIFCH-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)