Products 49557-33-7

CAS 49557-33-7 is the registry number for Otilonium Bromide Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl-[2-[4-[(2-heptoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide (CAS 49557-33-7) is a chemical compound with the molecular formula C28H41BrN2O4 and a molecular weight of 549.5 g/mol. IUPAC name: diethyl-[2-[4-[(2-heptoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide. InChIKey: YRQJCCFFSHSCEI-UHFFFAOYSA-N.

Identity
Molecular formulaC28H41BrN2O4
Molecular weight549.5 g/mol
IUPAC namediethyl-[2-[4-[(2-heptoxybenzoyl)amino]benzoyl]oxyethyl]-methylazanium bromide
InChIKeyYRQJCCFFSHSCEI-UHFFFAOYSA-N
SMILESCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)OCC[N+](C)(CC)CC.[Br-]

Computed by PubChem (NCBI)