Products 49570-64-1
CAS 49570-64-1 is the registry number for Betamethadol Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride (CAS 49570-64-1) is a chemical compound with the molecular formula C21H30ClNO and a molecular weight of 347.9 g/mol. IUPAC name: (3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride. InChIKey: GMNBUMFCZAZBQG-XLCHORMMSA-N.
| Molecular formula | C21H30ClNO |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | (3S,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-ol;hydrochloride |
| InChIKey | GMNBUMFCZAZBQG-XLCHORMMSA-N |
| SMILES | CC[C@@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)