CAS 49584-65-8 appears in our catalog under these names: 2,2,4,6,7-Pentamethyl-1,2,3,4-tetrahydroquinoline, 95%, 2,2,4,6,7-Pentamethyl-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline (CAS 49584-65-8) is a chemical compound with the molecular formula C14H21N and a molecular weight of 203.32 g/mol. IUPAC name: 2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline. InChIKey: ZHYQUVAZTCEITH-UHFFFAOYSA-N.
| Molecular formula | C14H21N |
|---|---|
| Molecular weight | 203.32 g/mol |
| IUPAC name | 2,2,4,6,7-pentamethyl-3,4-dihydro-1H-quinoline |
| InChIKey | ZHYQUVAZTCEITH-UHFFFAOYSA-N |
| SMILES | CC1CC(NC2=C1C=C(C(=C2)C)C)(C)C |
Computed by PubChem (NCBI)