CAS 49591-20-0 appears in our catalog under these names: N-tert-Butylbenzenesulfinimidoyl chloride, 80%, N–tert–Butylbenzenesulfinimidoyl Chloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
Tert-butylimino-chloro-phenyl-lambda4-sulfane (CAS 49591-20-0) is a chemical compound with the molecular formula C10H14ClNS and a molecular weight of 215.74 g/mol. IUPAC name: tert-butylimino-chloro-phenyl-lambda4-sulfane. InChIKey: RZJYQVFWNHEPTH-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNS |
|---|---|
| Molecular weight | 215.74 g/mol |
| IUPAC name | tert-butylimino-chloro-phenyl-lambda4-sulfane |
| InChIKey | RZJYQVFWNHEPTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=S(C1=CC=CC=C1)Cl |
Computed by PubChem (NCBI)