CAS 496-00-4 is the registry number for Dibromopropamidine. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
3-bromo-4-[3-(2-bromo-4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide (CAS 496-00-4) is a chemical compound with the molecular formula C17H18Br2N4O2 and a molecular weight of 470.2 g/mol. IUPAC name: 3-bromo-4-[3-(2-bromo-4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide. InChIKey: GMJFVGRUYJHMCO-UHFFFAOYSA-N.
| Molecular formula | C17H18Br2N4O2 |
|---|---|
| Molecular weight | 470.2 g/mol |
| IUPAC name | 3-bromo-4-[3-(2-bromo-4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide |
| InChIKey | GMJFVGRUYJHMCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=N)N)Br)OCCCOC2=C(C=C(C=C2)C(=N)N)Br |
Computed by PubChem (NCBI)