CAS 496023-52-0 is the registry number for WAY-601258, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg.
2-[[5-(4-methylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]acetamide (CAS 496023-52-0) is a chemical compound with the molecular formula C13H12N4OS2 and a molecular weight of 304.4 g/mol. IUPAC name: 2-[[5-(4-methylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]acetamide. InChIKey: IZADEABGHHLZBE-UHFFFAOYSA-N.
| Molecular formula | C13H12N4OS2 |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | 2-[[5-(4-methylphenyl)-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-yl]sulfanyl]acetamide |
| InChIKey | IZADEABGHHLZBE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CSC3=NN=C(N23)SCC(=O)N |
Computed by PubChem (NCBI)