CAS 496024-43-2 appears in our catalog under these names: Amlodipine Impurity 2, Amlodipine Impurity 31, AMLODIPINE IMPURITY 1, 5-Ethyl 7-methyl 6-(2-chlorophenyl)-3,4,6,7-tetrahydro-8-methyl-2H-1,4-benzoxazine-5,7-dicarboxylate, 3,4,6,7-Tetrahydro-1,4-Benzoxazine-rearranged Amlodipine. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Chemat. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg, 250mg.
5-O-ethyl 7-O-methyl 6-(2-chlorophenyl)-8-methyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine-5,7-dicarboxylate (CAS 496024-43-2) is a chemical compound with the molecular formula C20H22ClNO5 and a molecular weight of 391.8 g/mol. IUPAC name: 5-O-ethyl 7-O-methyl 6-(2-chlorophenyl)-8-methyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine-5,7-dicarboxylate. InChIKey: ZTKBXGUJDFQQPS-UHFFFAOYSA-N.
| Molecular formula | C20H22ClNO5 |
|---|---|
| Molecular weight | 391.8 g/mol |
| IUPAC name | 5-O-ethyl 7-O-methyl 6-(2-chlorophenyl)-8-methyl-3,4,6,7-tetrahydro-2H-1,4-benzoxazine-5,7-dicarboxylate |
| InChIKey | ZTKBXGUJDFQQPS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C(=C(C(C1C3=CC=CC=C3Cl)C(=O)OC)C)OCCN2 |
Computed by PubChem (NCBI)