CAS 496031-56-2 appears in our catalog under these names: Linezolid Impurity 41, Linezolid Impurity 12, (5R)-(3-(3-Fluoro-4-(4-morpholinyl)phenyl)-2-oxo-5-oxazolidinyl)methyl Acetate, {(5R)-3-(3-Fluoro-4-(4-morpholinyl)phenyl)-2-oxo-1.3-oxazolidin-5-yl}methyl acetate. Offered by: Chemat Brand, Hubei YoungXin, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
[(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate (CAS 496031-56-2) is a chemical compound with the molecular formula C16H19FN2O5 and a molecular weight of 338.33 g/mol. IUPAC name: [(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate. InChIKey: OSTZSWLRJGLQOS-CYBMUJFWSA-N.
| Molecular formula | C16H19FN2O5 |
|---|---|
| Molecular weight | 338.33 g/mol |
| IUPAC name | [(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl acetate |
| InChIKey | OSTZSWLRJGLQOS-CYBMUJFWSA-N |
| SMILES | CC(=O)OC[C@H]1CN(C(=O)O1)C2=CC(=C(C=C2)N3CCOCC3)F |
Computed by PubChem (NCBI)