CAS 49607-21-8 is the registry number for 2,4-Dinitro-L-Phenylalanine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-(2,4-dinitrophenyl)propanoic acid (CAS 49607-21-8) is a chemical compound with the molecular formula C9H9N3O6 and a molecular weight of 255.18 g/mol. IUPAC name: (2S)-2-amino-3-(2,4-dinitrophenyl)propanoic acid. InChIKey: LLVUHQYJZJUDAM-ZETCQYMHSA-N.
| Molecular formula | C9H9N3O6 |
|---|---|
| Molecular weight | 255.18 g/mol |
| IUPAC name | (2S)-2-amino-3-(2,4-dinitrophenyl)propanoic acid |
| InChIKey | LLVUHQYJZJUDAM-ZETCQYMHSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)