Products 49653-47-6

CAS 49653-47-6 is the registry number for tert-Butyl 2,2-dichloroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 2,2-dichloroacetate (CAS 49653-47-6) is a chemical compound with the molecular formula C6H10Cl2O2 and a molecular weight of 185.05 g/mol. IUPAC name: tert-butyl 2,2-dichloroacetate. InChIKey: FOLRKRMAFDGZRR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10Cl2O2
Molecular weight185.05 g/mol
IUPAC nametert-butyl 2,2-dichloroacetate
InChIKeyFOLRKRMAFDGZRR-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C(Cl)Cl

Computed by PubChem (NCBI)