CAS 496778-02-0 appears in our catalog under these names: 1-[(5-Bromothien-2-yl)sulfonyl]piperidine-4-carboxylic acid, 95%, 1-((5-Bromothiophen-2-yl)sulfonyl)piperidine-4-carboxylic acid, 95%, 1-((5-Bromothiophen-2-yl)sulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
1-(5-bromothiophen-2-yl)sulfonylpiperidine-4-carboxylic acid (CAS 496778-02-0) is a chemical compound with the molecular formula C10H12BrNO4S2 and a molecular weight of 354.2 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)sulfonylpiperidine-4-carboxylic acid. InChIKey: YALGRHPGPRVWRS-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO4S2 |
|---|---|
| Molecular weight | 354.2 g/mol |
| IUPAC name | 1-(5-bromothiophen-2-yl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | YALGRHPGPRVWRS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)O)S(=O)(=O)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)