Products 49689-66-9

CAS 49689-66-9 is the registry number for Z-Glu(obzl)-onp, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (CAS 49689-66-9) is a chemical compound with the molecular formula C26H24N2O8 and a molecular weight of 492.5 g/mol. IUPAC name: 5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: PARQXTFBGGEDHC-QHCPKHFHSA-N.

Identity
Molecular formulaC26H24N2O8
Molecular weight492.5 g/mol
IUPAC name5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate
InChIKeyPARQXTFBGGEDHC-QHCPKHFHSA-N
SMILESC1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)