CAS 49689-66-9 is the registry number for Z-Glu(obzl)-onp, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate (CAS 49689-66-9) is a chemical compound with the molecular formula C26H24N2O8 and a molecular weight of 492.5 g/mol. IUPAC name: 5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate. InChIKey: PARQXTFBGGEDHC-QHCPKHFHSA-N.
| Molecular formula | C26H24N2O8 |
|---|---|
| Molecular weight | 492.5 g/mol |
| IUPAC name | 5-O-benzyl 1-O-(4-nitrophenyl) (2S)-2-(phenylmethoxycarbonylamino)pentanedioate |
| InChIKey | PARQXTFBGGEDHC-QHCPKHFHSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC[C@@H](C(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)