CAS 497060-68-1 is the registry number for 2-(4-(tert-butyl)phenoxy)(3-pyridyl) 4-phenylpiperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
[2-(4-tert-butylphenoxy)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone (CAS 497060-68-1) is a chemical compound with the molecular formula C26H29N3O2 and a molecular weight of 415.5 g/mol. IUPAC name: [2-(4-tert-butylphenoxy)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone. InChIKey: CWAGONXGMALADR-UHFFFAOYSA-N.
| Molecular formula | C26H29N3O2 |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | [2-(4-tert-butylphenoxy)-3-pyridinyl]-(4-phenylpiperazin-1-yl)methanone |
| InChIKey | CWAGONXGMALADR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OC2=C(C=CC=N2)C(=O)N3CCN(CC3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)