CAS 49710-99-8 appears in our catalog under these names: Methoxamine Impurity 18, 1-(2-Hydroxy-5-methoxyphenyl)-1-propanone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 10mg, 50mg.
1-(2-hydroxy-5-methoxyphenyl)propan-1-one (CAS 49710-99-8) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(2-hydroxy-5-methoxyphenyl)propan-1-one. InChIKey: MLDZAGGFWSAWHF-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(2-hydroxy-5-methoxyphenyl)propan-1-one |
| InChIKey | MLDZAGGFWSAWHF-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=C(C=CC(=C1)OC)O |
Computed by PubChem (NCBI)