CAS 49757-42-8 appears in our catalog under these names: 4,4',4''-Trimethoxytrityl chloride, 4,4',4''-(Chloromethanetriyl)tris(methoxybenzene) 95%, 4,4',4''-TRIMETHOXYTRITYL CHLORIDE, TEC&, 4,4',4''-(Chloromethanetriyl)tris(methoxybenzene), 95%, 95%, 4,4',4"-Trimethoxytrityl chloride, 95%. Offered by: Biosynth, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 2g, 1g, 5g, 10g, 25g, 250mg, 100g.
1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene (CAS 49757-42-8) is a chemical compound with the molecular formula C22H21ClO3 and a molecular weight of 368.9 g/mol. IUPAC name: 1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene. InChIKey: OBFCMKPFILBCSQ-UHFFFAOYSA-N.
| Molecular formula | C22H21ClO3 |
|---|---|
| Molecular weight | 368.9 g/mol |
| IUPAC name | 1-[chloro-bis(4-methoxyphenyl)methyl]-4-methoxybenzene |
| InChIKey | OBFCMKPFILBCSQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)(C3=CC=C(C=C3)OC)Cl |
Computed by PubChem (NCBI)