CAS 49780-25-8 appears in our catalog under these names: 2,4-Dimethyl-5-nitro-1H-imidazole, 98%, 98%, 2,5-dimethyl-4-nitro-1H-imidazole, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
2,4-dimethyl-5-nitro-1H-imidazole (CAS 49780-25-8) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 2,4-dimethyl-5-nitro-1H-imidazole. InChIKey: UKAXKCXOBZGQAK-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 2,4-dimethyl-5-nitro-1H-imidazole |
| InChIKey | UKAXKCXOBZGQAK-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=N1)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)