Products 49783-84-8

CAS 49783-84-8 appears in our catalog under these names: 1,5-Dimethyl-1h-pyrazole-3-carbonyl chloride, 95%, 1,5-Dimethyl-1H-pyrazole-3-carbonyl chloride, 97%, 1,5-Dimethyl-1H-pyrazole-3-carbonyl chloride, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

1,5-dimethylpyrazole-3-carbonyl chloride (CAS 49783-84-8) is a chemical compound with the molecular formula C6H7ClN2O and a molecular weight of 158.58 g/mol. IUPAC name: 1,5-dimethylpyrazole-3-carbonyl chloride. InChIKey: BADBQYAILRGCBB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7ClN2O
Molecular weight158.58 g/mol
IUPAC name1,5-dimethylpyrazole-3-carbonyl chloride
InChIKeyBADBQYAILRGCBB-UHFFFAOYSA-N
SMILESCC1=CC(=NN1C)C(=O)Cl

Computed by PubChem (NCBI)