CAS 497931-76-7 appears in our catalog under these names: 3–(((Benzylthio)carbonothioyl)thio)propanoic acid, 3-[[(Benzylthio)carbonothioyl]thio]propionic Acid, >98.0%(T), 3-{((Benzylsulfanyl)methanethioyl)sulfanyl}propanoic acid, 3-(Benzylsulfanylthiocarbonylsulfanyl)propionic acid, 98%, 98%, 3-(((Benzylthio)carbonothioyl)thio)propanoic acid, 97%. Offered by: GLPBio, TCI, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 500mg, 1000mg, 100mg.
3-benzylsulfanylcarbothioylsulfanylpropanoic acid (CAS 497931-76-7) is a chemical compound with the molecular formula C11H12O2S3 and a molecular weight of 272.4 g/mol. IUPAC name: 3-benzylsulfanylcarbothioylsulfanylpropanoic acid. InChIKey: IJPDPFXRBLNDPQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2S3 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | 3-benzylsulfanylcarbothioylsulfanylpropanoic acid |
| InChIKey | IJPDPFXRBLNDPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC(=S)SCCC(=O)O |
Computed by PubChem (NCBI)