CAS 49805-32-5 appears in our catalog under these names: Cis-3-aminocyclopentanecarboxylic acid, 95%, cis-3-Aminocyclopentanecarboxylic Acid, >95%, >95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
Cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid (CAS 49805-32-5) is a chemical compound with the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. IUPAC name: cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid. InChIKey: MLLSSTJTARJLHK-UHNVWZDZSA-N.
| Molecular formula | C6H11NO2 |
|---|---|
| Molecular weight | 129.16 g/mol |
| IUPAC name | cis-(1R,3S)-3-aminocyclopentane-1-carboxylic acid |
| InChIKey | MLLSSTJTARJLHK-UHNVWZDZSA-N |
| SMILES | C1C[C@@H](C[C@@H]1C(=O)O)N |
Computed by PubChem (NCBI)