Products 498565-47-2
CAS 498565-47-2 is the registry number for tert-Butyl (2S)-2-amino-4-methanesulfinylbutanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl (2S)-2-amino-4-methylsulfinylbutanoate (CAS 498565-47-2) is a chemical compound with the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. IUPAC name: tert-butyl (2S)-2-amino-4-methylsulfinylbutanoate. InChIKey: JBZIHHGKWJYDMF-CVSPRKDYSA-N.
| Molecular formula | C9H19NO3S |
|---|---|
| Molecular weight | 221.32 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-4-methylsulfinylbutanoate |
| InChIKey | JBZIHHGKWJYDMF-CVSPRKDYSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCS(=O)C)N |
Computed by PubChem (NCBI)