CAS 499-33-2 is the registry number for Furcatin. Offered by: Biosynth. Available pack sizes: 1mg, 2mg.
Furcatin is a disaccharide derivative that is beta-D-apiofuranosyl-(16)-D-glucopyranose with a 4-(prop-2-en-1-yl)phenyl group substituent. It has a role as a metabolite. It is functionally related to a beta-D-apiofuranosyl-(1->6)-D-glucopyranose.
Source: ChEBI
| Molecular formula | C20H28O10 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | (2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(4-prop-2-enylphenoxy)oxane-3,4,5-triol |
| InChIKey | HLTAEJNADMCLOV-LTRJMQNCSA-N |
| SMILES | C=CCC1=CC=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@](CO3)(CO)O)O)O)O)O |
Computed by PubChem (NCBI)