CAS 499-87-6 appears in our catalog under these names: 3-Deoxy-D-ribo-hexono-1,4-lactone, 3-Deoxy-D-ribo-hexonic acid, γ-lactone. Offered by: TRC, Chemat. Available pack sizes: 25mg, 10mg, 1mg, 2mg, 5mg.
(3R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxyoxolan-2-one (CAS 499-87-6) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. IUPAC name: (3R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxyoxolan-2-one. InChIKey: NSEFGBGANVMEIR-WDCZJNDASA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | (3R,5S)-5-[(1R)-1,2-dihydroxyethyl]-3-hydroxyoxolan-2-one |
| InChIKey | NSEFGBGANVMEIR-WDCZJNDASA-N |
| SMILES | C1[C@H](C(=O)O[C@@H]1[C@@H](CO)O)O |
Computed by PubChem (NCBI)