CAS 499183-58-3 is the registry number for (E)-1-([1,1'-Biphenyl]-4-yl)-3-(4-isopropylphenyl)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(4-phenylphenyl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one (CAS 499183-58-3) is a chemical compound with the molecular formula C24H22O and a molecular weight of 326.4 g/mol. IUPAC name: (E)-1-(4-phenylphenyl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one. InChIKey: KQBJJRUFRDATKY-LICLKQGHSA-N.
| Molecular formula | C24H22O |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | (E)-1-(4-phenylphenyl)-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| InChIKey | KQBJJRUFRDATKY-LICLKQGHSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)/C=C/C(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)