CAS 499197-59-0 is the registry number for 2,4-dichlorophenyl 4-(5-chloro-2-methylphenyl)piperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone (CAS 499197-59-0) is a chemical compound with the molecular formula C18H17Cl3N2O and a molecular weight of 383.7 g/mol. IUPAC name: [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone. InChIKey: LOBYXIXZTYJWQB-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl3N2O |
|---|---|
| Molecular weight | 383.7 g/mol |
| IUPAC name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(2,4-dichlorophenyl)methanone |
| InChIKey | LOBYXIXZTYJWQB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)