CAS 499214-82-3 is the registry number for 4-(Difluoromethyl)-1-trityl-1H-imidazole. Offered by: Biosynth. Available pack sizes: 5g, 10g, 25g.
4-(difluoromethyl)-1-tritylimidazole (CAS 499214-82-3) is a chemical compound with the molecular formula C23H18F2N2 and a molecular weight of 360.4 g/mol. IUPAC name: 4-(difluoromethyl)-1-tritylimidazole. InChIKey: BWFNXNDRKVXUDG-UHFFFAOYSA-N.
| Molecular formula | C23H18F2N2 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 4-(difluoromethyl)-1-tritylimidazole |
| InChIKey | BWFNXNDRKVXUDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C(F)F |
Computed by PubChem (NCBI)