Products 499769-94-7

CAS 499769-94-7 is the registry number for Benzo-2,1,3-thiadiazole-4-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2,1,3-benzothiadiazol-4-ylboronic acid (CAS 499769-94-7) is a chemical compound with the molecular formula C6H5BN2O2S and a molecular weight of 180.00 g/mol. IUPAC name: 2,1,3-benzothiadiazol-4-ylboronic acid. InChIKey: RVXHEMODAHHASJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BN2O2S
Molecular weight180.00 g/mol
IUPAC name2,1,3-benzothiadiazol-4-ylboronic acid
InChIKeyRVXHEMODAHHASJ-UHFFFAOYSA-N
SMILESB(C1=CC=CC2=NSN=C12)(O)O

Computed by PubChem (NCBI)