CAS 499771-19-6 is the registry number for 5-((3-Nitropyridin-2-yl)thio)-1,3,4-thiadiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine (CAS 499771-19-6) is a chemical compound with the molecular formula C7H5N5O2S2 and a molecular weight of 255.3 g/mol. IUPAC name: 5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine. InChIKey: FYXLANAMYDYSCN-UHFFFAOYSA-N.
| Molecular formula | C7H5N5O2S2 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | 5-[(3-nitro-2-pyridinyl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | FYXLANAMYDYSCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)SC2=NN=C(S2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)