CAS 499777-84-3 is the registry number for Dechloro N-tert-Butyl Cimicoxib. Offered by: TRC. Available pack sizes: 1g.
N-tert-butyl-4-[5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide (CAS 499777-84-3) is a chemical compound with the molecular formula C20H22FN3O3S and a molecular weight of 403.5 g/mol. IUPAC name: N-tert-butyl-4-[5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide. InChIKey: KZVFRDBKQZRUIB-UHFFFAOYSA-N.
| Molecular formula | C20H22FN3O3S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | N-tert-butyl-4-[5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide |
| InChIKey | KZVFRDBKQZRUIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)N2C=NC=C2C3=CC(=C(C=C3)OC)F |
Computed by PubChem (NCBI)