CAS 499777-85-4 is the registry number for N-tert-Butyl Cimicoxib. Offered by: TRC. Available pack sizes: 500mg.
N-tert-butyl-4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide (CAS 499777-85-4) is a chemical compound with the molecular formula C20H21ClFN3O3S and a molecular weight of 437.9 g/mol. IUPAC name: N-tert-butyl-4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide. InChIKey: FRZYUVYOHGEOAJ-UHFFFAOYSA-N.
| Molecular formula | C20H21ClFN3O3S |
|---|---|
| Molecular weight | 437.9 g/mol |
| IUPAC name | N-tert-butyl-4-[4-chloro-5-(3-fluoro-4-methoxyphenyl)imidazol-1-yl]benzenesulfonamide |
| InChIKey | FRZYUVYOHGEOAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)N2C=NC(=C2C3=CC(=C(C=C3)OC)F)Cl |
Computed by PubChem (NCBI)