CAS 4998-38-3 is the registry number for 1H,1H,11H-Perfluoroundecyl acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl prop-2-enoate (CAS 4998-38-3) is a chemical compound with the molecular formula C14H6F20O2 and a molecular weight of 586.16 g/mol. IUPAC name: 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl prop-2-enoate. InChIKey: HBFWXGZKVGSZKO-UHFFFAOYSA-N.
| Molecular formula | C14H6F20O2 |
|---|---|
| Molecular weight | 586.16 g/mol |
| IUPAC name | 1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11-icosafluoroundecyl prop-2-enoate |
| InChIKey | HBFWXGZKVGSZKO-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OC(C(C(C(C(C(C(C(C(C(CF)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)