CAS 4999-79-5 appears in our catalog under these names: 17-beta-Estradiol-3-O-Sulfate Sodium, 17beta-Estradiol 3-O-Sulfate Sodium, >95% (HPLC), 17β-Estradiol sulfate sodium/ 99%, 17β–Estradiol 3–O–Sulfate (sodium salt), 17β-Estradiol sodium sulfate, ≥98%, ≥98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: on request, 100mg, 1g, 50mg, 1mg, 25mg, 5mg, 25 mg.
Sodium [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfate (CAS 4999-79-5) is a chemical compound with the molecular formula C18H23NaO5S and a molecular weight of 374.4 g/mol. IUPAC name: sodium [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfate. InChIKey: LMJQCTISQYSLPF-CMZLOHJFSA-M.
| Molecular formula | C18H23NaO5S |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | sodium [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] sulfate |
| InChIKey | LMJQCTISQYSLPF-CMZLOHJFSA-M |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=C3C=CC(=C4)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)