CAS 50-10-2 appears in our catalog under these names: Oxyphenonium Bromide, Oxyphenonium betaromide, >95% (HPLC), Oxyphenonium (bromide), Oxyphenonium (bromide), 98%, 98%, Oxyphenonium (bromide) (Standard). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 100mg, 10mg, 50mg, 25mg, 1g, 500mg, 5mg.
2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide (CAS 50-10-2) is a chemical compound with the molecular formula C21H34BrNO3 and a molecular weight of 428.4 g/mol. IUPAC name: 2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide. InChIKey: UKLQXHUGTKWPSR-UHFFFAOYSA-M.
| Molecular formula | C21H34BrNO3 |
|---|---|
| Molecular weight | 428.4 g/mol |
| IUPAC name | 2-(2-cyclohexyl-2-hydroxy-2-phenylacetyl)oxyethyl-diethyl-methylazanium bromide |
| InChIKey | UKLQXHUGTKWPSR-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)CCOC(=O)C(C1CCCCC1)(C2=CC=CC=C2)O.[Br-] |
Computed by PubChem (NCBI)