CAS 50-58-8 is the registry number for (2S,3S)-3,4-Dimethyl-2-phenylmorpholine L-tartrate. Offered by: TRC. Available pack sizes: 500mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine (CAS 50-58-8) is a chemical compound with the molecular formula C16H23NO7 and a molecular weight of 341.36 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine. InChIKey: VEPOHXYIFQMVHW-PVJVQHJQSA-N.
| Molecular formula | C16H23NO7 |
|---|---|
| Molecular weight | 341.36 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;(2S,3S)-3,4-dimethyl-2-phenylmorpholine |
| InChIKey | VEPOHXYIFQMVHW-PVJVQHJQSA-N |
| SMILES | C[C@H]1[C@@H](OCCN1C)C2=CC=CC=C2.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)