CAS 5001-82-1 is the registry number for Trimethylolacetylenediureine. Offered by: Chemat Brand. Available pack sizes: on request.
3,4,6-tris(hydroxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione (CAS 5001-82-1) is a chemical compound with the molecular formula C7H12N4O5 and a molecular weight of 232.19 g/mol. IUPAC name: 3,4,6-tris(hydroxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione. InChIKey: IQAIFQCNPCBECX-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O5 |
|---|---|
| Molecular weight | 232.19 g/mol |
| IUPAC name | 3,4,6-tris(hydroxymethyl)-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-2,5-dione |
| InChIKey | IQAIFQCNPCBECX-UHFFFAOYSA-N |
| SMILES | C(N1C2C(N(C(=O)N2)CO)N(C1=O)CO)O |
Computed by PubChem (NCBI)