CAS 500139-01-5 appears in our catalog under these names: 5,7-Difluoro-3-iodo-1-(phenylsulfonyl)-1h-indole, 95%, 5,7-Difluoro-3-iodo-1-(phenylsulfonyl)-1H-indole, 98+%, 5,7-Difluoro-3-iodo-1-(phenylsulfonyl)-1H-indole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
1-(benzenesulfonyl)-5,7-difluoro-3-iodoindole (CAS 500139-01-5) is a chemical compound with the molecular formula C14H8F2INO2S and a molecular weight of 419.19 g/mol. IUPAC name: 1-(benzenesulfonyl)-5,7-difluoro-3-iodoindole. InChIKey: MAJBTMPMUUCYME-UHFFFAOYSA-N.
| Molecular formula | C14H8F2INO2S |
|---|---|
| Molecular weight | 419.19 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5,7-difluoro-3-iodoindole |
| InChIKey | MAJBTMPMUUCYME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=C(C3=C2C(=CC(=C3)F)F)I |
Computed by PubChem (NCBI)