CAS 500292-48-8 appears in our catalog under these names: Rilpivirine Desmethyl Impurity, DESMETHYL RILPIVIRINE. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 25MG.
4-[[4-[4-[(E)-2-cyanoethenyl]-2-methylanilino]pyrimidin-2-yl]amino]benzonitrile (CAS 500292-48-8) is a chemical compound with the molecular formula C21H16N6 and a molecular weight of 352.4 g/mol. IUPAC name: 4-[[4-[4-[(E)-2-cyanoethenyl]-2-methylanilino]pyrimidin-2-yl]amino]benzonitrile. InChIKey: FHPSDGUUMXPNGR-NSCUHMNNSA-N.
| Molecular formula | C21H16N6 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 4-[[4-[4-[(E)-2-cyanoethenyl]-2-methylanilino]pyrimidin-2-yl]amino]benzonitrile |
| InChIKey | FHPSDGUUMXPNGR-NSCUHMNNSA-N |
| SMILES | CC1=C(C=CC(=C1)/C=C/C#N)NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)