CAS 5005-62-9 appears in our catalog under these names: 4-Amino-3,5,6-trichloro-2-(trichloromethyl)pyridine, 95%, 2,3,5-Trichloro-6-(trichloromethyl)pyridin-4-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 0,5g.
2,3,5-trichloro-6-(trichloromethyl)pyridin-4-amine (CAS 5005-62-9) is a chemical compound with the molecular formula C6H2Cl6N2 and a molecular weight of 314.8 g/mol. IUPAC name: 2,3,5-trichloro-6-(trichloromethyl)pyridin-4-amine. InChIKey: VNJVZJNBTWPKNX-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl6N2 |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 2,3,5-trichloro-6-(trichloromethyl)pyridin-4-amine |
| InChIKey | VNJVZJNBTWPKNX-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(Cl)(Cl)Cl)Cl)N |
Computed by PubChem (NCBI)