CAS 500533-95-9 appears in our catalog under these names: 5-Carboxyfluorescein, 95%, 4-(6-Hydroxy-3-oxo-3H-xanthen-9-yl)isophthalic acid, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 5g, 1g, 250mg, on request.
4-(3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid (CAS 500533-95-9) is a chemical compound with the molecular formula C21H12O7 and a molecular weight of 376.3 g/mol. IUPAC name: 4-(3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid. InChIKey: VPMWLNJETPKSSC-UHFFFAOYSA-N.
| Molecular formula | C21H12O7 |
|---|---|
| Molecular weight | 376.3 g/mol |
| IUPAC name | 4-(3-hydroxy-6-oxoxanthen-9-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | VPMWLNJETPKSSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)C2=C3C=CC(=O)C=C3OC4=C2C=CC(=C4)O |
Computed by PubChem (NCBI)