CAS 500556-93-4 appears in our catalog under these names: 2S-2-Amino-7-aza-bicyclo[2.2.1]heptane-7-carboxylic acid tert-butyl ester, 95%, rel-(1R,2S,4S)-tert-Butyl 2-amino-7-azabicyclo(2.2.1)heptane-7-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
Tert-butyl (1S,2R,4R)-2-amino-7-azabicyclo[2.2.1]heptane-7-carboxylate (CAS 500556-93-4) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,2R,4R)-2-amino-7-azabicyclo[2.2.1]heptane-7-carboxylate. InChIKey: JRZFZVWZIJNIEQ-HLTSFMKQSA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,2R,4R)-2-amino-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| InChIKey | JRZFZVWZIJNIEQ-HLTSFMKQSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1[C@@H](C2)N |
Computed by PubChem (NCBI)