Products 500596-39-4

CAS 500596-39-4 is the registry number for 5,5-Dimethylocta-2,7-diynoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5,5-dimethylocta-2,7-diynoic acid (CAS 500596-39-4) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: 5,5-dimethylocta-2,7-diynoic acid. InChIKey: OYVUAEOWBHHVNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12O2
Molecular weight164.20 g/mol
IUPAC name5,5-dimethylocta-2,7-diynoic acid
InChIKeyOYVUAEOWBHHVNQ-UHFFFAOYSA-N
SMILESCC(C)(CC#C)CC#CC(=O)O

Computed by PubChem (NCBI)