CAS 500715-03-7 appears in our catalog under these names: IK1 inhibitor PA-6/ 98.77% (existing batch purity), IK1 inhibitor PA–6, IK1 inhibitor PA-6, N,N′′-[1,5-Pentanediylbis(oxy-4,1-phenylene)]bis[benzenecarboximidamide], IK1 inhibitor PA-6, 99.29%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
N'-[4-[5-[4-[[amino(phenyl)methylidene]amino]phenoxy]pentoxy]phenyl]benzenecarboximidamide (CAS 500715-03-7) is a chemical compound with the molecular formula C31H32N4O2 and a molecular weight of 492.6 g/mol. IUPAC name: N'-[4-[5-[4-[[amino(phenyl)methylidene]amino]phenoxy]pentoxy]phenyl]benzenecarboximidamide. InChIKey: PETGITKEGWIZEL-UHFFFAOYSA-N.
| Molecular formula | C31H32N4O2 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | N'-[4-[5-[4-[[amino(phenyl)methylidene]amino]phenoxy]pentoxy]phenyl]benzenecarboximidamide |
| InChIKey | PETGITKEGWIZEL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=NC2=CC=C(C=C2)OCCCCCOC3=CC=C(C=C3)N=C(C4=CC=CC=C4)N)N |
Computed by PubChem (NCBI)