CAS 500789-05-9 is the registry number for Boc-(R)-3-amino-3-(2-chlorophenyl)propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
(3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 500789-05-9) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: (3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JBKHFGREKMCWAU-LLVKDONJSA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | (3R)-3-(2-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JBKHFGREKMCWAU-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)C1=CC=CC=C1Cl |
Computed by PubChem (NCBI)