Products 500883-59-0
CAS 500883-59-0 is the registry number for DDAO phosphate (diammonium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Azane;(6,8-dichloro-9,9-dimethyl-7-oxoacridin-2-yl) dihydrogen phosphate (CAS 500883-59-0) is a chemical compound with the molecular formula C15H18Cl2N3O5P and a molecular weight of 422.2 g/mol. IUPAC name: azane;(6,8-dichloro-9,9-dimethyl-7-oxoacridin-2-yl) dihydrogen phosphate. InChIKey: BJSNVTPPOAOWCF-UHFFFAOYSA-N.
| Molecular formula | C15H18Cl2N3O5P |
|---|---|
| Molecular weight | 422.2 g/mol |
| IUPAC name | azane;(6,8-dichloro-9,9-dimethyl-7-oxoacridin-2-yl) dihydrogen phosphate |
| InChIKey | BJSNVTPPOAOWCF-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)OP(=O)(O)O)N=C3C1=C(C(=O)C(=C3)Cl)Cl)C.N.N |
Computed by PubChem (NCBI)
Synonyms:
DDAO phosphate (diammonium)