CAS 500996-04-3 appears in our catalog under these names: 1–Benzyl–3–methyl–1H–imidazol–3–ium tetrafluoroborate, 1-Benzyl-3-methyl-1H-imidazol-3-ium tetrafluoroborate, 98%, 1-BENZYL-3-METHYLIMIDAZOLIUM TETRAFLUOR&, 1-Benzyl-3-methylimidazolium tetrafluoroborate, 98%, 98%, 1-Benzyl-3-methylimidazolium Tetrafluoroborate, >98.0%(HPLC)(N). Offered by: GLPBio, Fluorochem, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 1g, 5g, 25g, 50G, 10g, 300g, 400g.
1-benzyl-3-methylimidazol-3-ium tetrafluoroborate (CAS 500996-04-3) is a chemical compound with the molecular formula C11H13BF4N2 and a molecular weight of 260.04 g/mol. IUPAC name: 1-benzyl-3-methylimidazol-3-ium tetrafluoroborate. InChIKey: QULDEUUWXMCUFO-UHFFFAOYSA-N.
| Molecular formula | C11H13BF4N2 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 1-benzyl-3-methylimidazol-3-ium tetrafluoroborate |
| InChIKey | QULDEUUWXMCUFO-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.C[N+]1=CN(C=C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)