Products 501009-09-2
CAS 501009-09-2 appears in our catalog under these names: 2-Bromo-5-chloro-3-iodobenzoic acid, 95%, 2-Bromo-5-chloro-3-iodobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-bromo-5-chloro-3-iodobenzoic acid (CAS 501009-09-2) is a chemical compound with the molecular formula C7H3BrClIO2 and a molecular weight of 361.36 g/mol. IUPAC name: 2-bromo-5-chloro-3-iodobenzoic acid. InChIKey: HCNIYHWHWCIJLY-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClIO2 |
|---|---|
| Molecular weight | 361.36 g/mol |
| IUPAC name | 2-bromo-5-chloro-3-iodobenzoic acid |
| InChIKey | HCNIYHWHWCIJLY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)I)Cl |
Computed by PubChem (NCBI)