CAS 501081-21-6 is the registry number for 1-((4-Nitrophenyl)methyl)-4-(1,3-thiazol-2-yl)piperazine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]-1,3-thiazole (CAS 501081-21-6) is a chemical compound with the molecular formula C14H16N4O2S and a molecular weight of 304.37 g/mol. IUPAC name: 2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]-1,3-thiazole. InChIKey: VFZUGIDSASRHPF-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O2S |
|---|---|
| Molecular weight | 304.37 g/mol |
| IUPAC name | 2-[4-[(4-nitrophenyl)methyl]piperazin-1-yl]-1,3-thiazole |
| InChIKey | VFZUGIDSASRHPF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=C(C=C2)[N+](=O)[O-])C3=NC=CS3 |
Computed by PubChem (NCBI)