CAS 501100-25-0 is the registry number for 5-(4-Fluorophenyl)-4-iodo-1H-pyrazol-3-amine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(4-fluorophenyl)-4-iodo-1H-pyrazol-3-amine (CAS 501100-25-0) is a chemical compound with the molecular formula C9H7FIN3 and a molecular weight of 303.07 g/mol. IUPAC name: 5-(4-fluorophenyl)-4-iodo-1H-pyrazol-3-amine. InChIKey: KIXVASOFUIPZPU-UHFFFAOYSA-N.
| Molecular formula | C9H7FIN3 |
|---|---|
| Molecular weight | 303.07 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-4-iodo-1H-pyrazol-3-amine |
| InChIKey | KIXVASOFUIPZPU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=NN2)N)I)F |
Computed by PubChem (NCBI)