CAS 501434-74-8 appears in our catalog under these names: 4-Bromo-7-(thiophen-2-yl)benzo[c][1,2,5]thiadiazole, 98%, 98%, 2,1,3-Benzothiadiazole, 4-broMo-7-(2-thienyl)-, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-7-thiophen-2-yl-2,1,3-benzothiadiazole (CAS 501434-74-8) is a chemical compound with the molecular formula C10H5BrN2S2 and a molecular weight of 297.2 g/mol. IUPAC name: 4-bromo-7-thiophen-2-yl-2,1,3-benzothiadiazole. InChIKey: VVQIEATVJBTJRD-UHFFFAOYSA-N.
| Molecular formula | C10H5BrN2S2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 4-bromo-7-thiophen-2-yl-2,1,3-benzothiadiazole |
| InChIKey | VVQIEATVJBTJRD-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC=C(C3=NSN=C23)Br |
Computed by PubChem (NCBI)